C11H11NO4 — CID 94654403
(Z)-3-(1,3-benzodioxol-5-yl)-N-methoxyprop-2-enamide (PubChem CID 94654403) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-N-methoxyprop-2-enamide.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-methoxyprop-2-enamide |
|---|---|
| PubChem CID | 94654403 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-N-methoxyprop-2-enamide |
| SMILES | CONC(=O)/C=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H11NO4/c1-14-12-11(13)5-3-8-2-4-9-10(6-8)16-7-15-9/h2-6H,7H2,1H3,(H,12,13)/b5-3- |
| InChIKey | DZQOXGAGZKCVIR-HYXAFXHYSA-N |
| XLogP | 1.11 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|