About [(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate
[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate (PubChem CID 101356088) has the molecular formula C12H12O5
and a molecular weight of 236.22 g/mol. Its IUPAC name is [(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate.
Analyze [(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate?
The IUPAC name of [(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate (CID 101356088) is [(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate.
What is the SMILES notation for [(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate?
The canonical SMILES for [(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate is COC(=O)OC/C=C/c1ccc2c(c1)OCO2.
What is the InChIKey of [(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate?
The InChIKey is QMPDTKCSYPQOQY-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H12O5/c1-14-12(13)15-6-2-3-9-4-5-10-11(7-9)17-8-16-10/h2-5,7H,6,8H2,1H3/b3-2+.
What are the key properties of [(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate?
[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate has a molecular weight of 236.22 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-3-(1,3-benzodioxol-5-yl)prop-2-enyl] methyl carbonate is sourced from PubChem (CID 101356088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).