C11H12O3 — CID 6442051
formaldehyde;5-[(E)-prop-1-enyl]-1,3-benzodioxole (PubChem CID 6442051) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is formaldehyde;5-[(E)-prop-1-enyl]-1,3-benzodioxole.
| Compound Name | formaldehyde;5-[(E)-prop-1-enyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 6442051 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | formaldehyde;5-[(E)-prop-1-enyl]-1,3-benzodioxole |
| SMILES | C/C=C/c1ccc2c(c1)OCO2.C=O |
| InChI | InChI=1S/C10H10O2.CH2O/c1-2-3-8-4-5-9-10(6-8)12-7-11-9;1-2/h2-6H,7H2,1H3;1H2/b3-2+; |
| InChIKey | LCJWZZPVKHPAMV-SQQVDAMQSA-N |
| XLogP | 2.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |