C10H8O3 — CID 5374493
(E)-3-(1,3-benzodioxol-5-yl)prop-2-enal (PubChem CID 5374493) has the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)prop-2-enal.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)prop-2-enal |
|---|---|
| PubChem CID | 5374493 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)prop-2-enal |
| SMILES | O=C/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H8O3/c11-5-1-2-8-3-4-9-10(6-8)13-7-12-9/h1-6H,7H2/b2-1+ |
| InChIKey | HZUFMSJUNLSDSZ-OWOJBTEDSA-N |
| XLogP | 1.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|