(2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid

C14H12O4 — CID 13001439

IUPAC(2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid
SMILESO=C(O)/C=C/C=C/C=C/c1ccc2c(c1)OCO2
InChIInChI=1S/C14H12O4/c15-14(16)6-4-2-1-3-5-11-7-8-12-13(9-11)18-10-17-12/h1-9H,10H2,(H,15,16)/b2-1+,5-3+,6-4+
InChIKeyUGHIBFVYNSBUCK-CRQXNEITSA-N
MW244.25 g/mol
LogP2.63
Rot. Bonds4

About (2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid

(2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid (PubChem CID 13001439) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is (2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid.

Molecular Properties

Compound Name(2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid
PubChem CID13001439
Molecular FormulaC14H12O4
Molecular Weight244.25 g/mol
Exact Mass244.07
IUPAC Name(2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid
SMILESO=C(O)/C=C/C=C/C=C/c1ccc2c(c1)OCO2
InChIInChI=1S/C14H12O4/c15-14(16)6-4-2-1-3-5-11-7-8-12-13(9-11)18-10-17-12/h1-9H,10H2,(H,15,16)/b2-1+,5-3+,6-4+
InChIKeyUGHIBFVYNSBUCK-CRQXNEITSA-N
XLogP2.63
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.25
LogP ≤ 52.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid?
The IUPAC name of (2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid (CID 13001439) is (2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid.
What is the SMILES notation for (2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid?
The canonical SMILES for (2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid is O=C(O)/C=C/C=C/C=C/c1ccc2c(c1)OCO2.
What is the InChIKey of (2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid?
The InChIKey is UGHIBFVYNSBUCK-CRQXNEITSA-N. The full InChI is InChI=1S/C14H12O4/c15-14(16)6-4-2-1-3-5-11-7-8-12-13(9-11)18-10-17-12/h1-9H,10H2,(H,15,16)/b2-1+,5-3+,6-4+.
What are the key properties of (2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid?
(2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid has a molecular weight of 244.25 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E,6E)-7-(1,3-benzodioxol-5-yl)hepta-2,4,6-trienoic acid is sourced from PubChem (CID 13001439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).