C24H20O6 — CID 98043226
(1E,3E,6S,7E,9E)-1,10-bis(1,3-benzodioxol-5-yl)-6-hydroxydeca-1,3,7,9-tetraen-5-one (PubChem CID 98043226) has the molecular formula C24H20O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is (1E,3E,6S,7E,9E)-1,10-bis(1,3-benzodioxol-5-yl)-6-hydroxydeca-1,3,7,9-tetraen-5-one.
| Compound Name | (1E,3E,6S,7E,9E)-1,10-bis(1,3-benzodioxol-5-yl)-6-hydroxydeca-1,3,7,9-tetraen-5-one |
|---|---|
| PubChem CID | 98043226 |
| Molecular Formula | C24H20O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (1E,3E,6S,7E,9E)-1,10-bis(1,3-benzodioxol-5-yl)-6-hydroxydeca-1,3,7,9-tetraen-5-one |
| SMILES | O=C(/C=C/C=C/c1ccc2c(c1)OCO2)[C@@H](O)/C=C/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H20O6/c25-19(7-3-1-5-17-9-11-21-23(13-17)29-15-27-21)20(26)8-4-2-6-18-10-12-22-24(14-18)30-16-28-22/h1-14,19,25H,15-16H2/b5-1+,6-2+,7-3+,8-4+/t19-/m0/s1 |
| InChIKey | IFYHXLAEKZCPAL-RAXTVVSESA-N |
| XLogP | 3.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|