C24H31NO3 — CID 88780505
(2E)-5-(1,3-benzodioxol-5-yl)-N,N-dicyclohexylpenta-2,4-dienamide (PubChem CID 88780505) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is (2E)-5-(1,3-benzodioxol-5-yl)-N,N-dicyclohexylpenta-2,4-dienamide.
| Compound Name | (2E)-5-(1,3-benzodioxol-5-yl)-N,N-dicyclohexylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 88780505 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (2E)-5-(1,3-benzodioxol-5-yl)-N,N-dicyclohexylpenta-2,4-dienamide |
| SMILES | O=C(/C=C/C=Cc1ccc2c(c1)OCO2)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H31NO3/c26-24(14-8-7-9-19-15-16-22-23(17-19)28-18-27-22)25(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h7-9,14-17,20-21H,1-6,10-13,18H2/b9-7?,14-8+ |
| InChIKey | ASBRLVSAFPUFOI-JLKKQUCFSA-N |
| XLogP | 5.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|