C16H19NO3 — CID 3054389
5-(1,3-benzodioxol-5-yl)-N,N-diethylpenta-2,4-dienamide (PubChem CID 3054389) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N,N-diethylpenta-2,4-dienamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N,N-diethylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 3054389 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N,N-diethylpenta-2,4-dienamide |
| SMILES | CCN(CC)C(=O)C=CC=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H19NO3/c1-3-17(4-2)16(18)8-6-5-7-13-9-10-14-15(11-13)20-12-19-14/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | HERKSPCMCQYVSE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|