C17H21NO3 — CID 53302838
(2E,4E)-5-(1,3-benzodioxol-5-yl)-N-butyl-N-methylpenta-2,4-dienamide (PubChem CID 53302838) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-butyl-N-methylpenta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-butyl-N-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 53302838 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N-butyl-N-methylpenta-2,4-dienamide |
| SMILES | CCCCN(C)C(=O)/C=C/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H21NO3/c1-3-4-11-18(2)17(19)8-6-5-7-14-9-10-15-16(12-14)21-13-20-15/h5-10,12H,3-4,11,13H2,1-2H3/b7-5+,8-6+ |
| InChIKey | CHPFXLCUGYESAV-KQQUZDAGSA-N |
| XLogP | 3.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|