C20H29NO2 — CID 53302952
(2E,4E)-5-(1,3-benzodioxol-5-yl)-N,N-dibutylpenta-2,4-dien-1-amine (PubChem CID 53302952) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (2E,4E)-5-(1,3-benzodioxol-5-yl)-N,N-dibutylpenta-2,4-dien-1-amine.
| Compound Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N,N-dibutylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 53302952 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-N,N-dibutylpenta-2,4-dien-1-amine |
| SMILES | CCCCN(C/C=C/C=C/c1ccc2c(c1)OCO2)CCCC |
| InChI | InChI=1S/C20H29NO2/c1-3-5-13-21(14-6-4-2)15-9-7-8-10-18-11-12-19-20(16-18)23-17-22-19/h7-12,16H,3-6,13-15,17H2,1-2H3/b9-7+,10-8+ |
| InChIKey | WMTVOQZGKMINQC-FIFLTTCUSA-N |
| XLogP | 4.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|