C35H30O4 — CID 59815185
5-[(E)-2-[7-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-9-methyl-9-propylfluoren-2-yl]ethenyl]-1,3-benzodioxole (PubChem CID 59815185) has the molecular formula C35H30O4 and a molecular weight of 514.62 g/mol. Its IUPAC name is 5-[(E)-2-[7-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-9-methyl-9-propylfluoren-2-yl]ethenyl]-1,3-benzodioxole.
| Compound Name | 5-[(E)-2-[7-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-9-methyl-9-propylfluoren-2-yl]ethenyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 59815185 |
| Molecular Formula | C35H30O4 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 5-[(E)-2-[7-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-9-methyl-9-propylfluoren-2-yl]ethenyl]-1,3-benzodioxole |
| SMILES | CCCC1(C)c2cc(/C=C/c3ccc4c(c3)OCO4)ccc2-c2ccc(/C=C/c3ccc4c(c3)OCO4)cc21 |
| InChI | InChI=1S/C35H30O4/c1-3-16-35(2)29-17-23(4-6-25-10-14-31-33(19-25)38-21-36-31)8-12-27(29)28-13-9-24(18-30(28)35)5-7-26-11-15-32-34(20-26)39-22-37-32/h4-15,17-20H,3,16,21-22H2,1-2H3/b6-4+,7-5+ |
| InChIKey | XCIOJLPTBSHBJT-YDFGWWAZSA-N |
| XLogP | 8.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|