C20H20NO2+ — CID 75196163
2-[2-(1,3-benzodioxol-5-yl)ethenyl]-1,3,3-trimethylindol-1-ium (PubChem CID 75196163) has the molecular formula C20H20NO2+ and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)ethenyl]-1,3,3-trimethylindol-1-ium.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)ethenyl]-1,3,3-trimethylindol-1-ium |
|---|---|
| PubChem CID | 75196163 |
| Molecular Formula | C20H20NO2+ |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)ethenyl]-1,3,3-trimethylindol-1-ium |
| SMILES | C[N+]1=C(C=Cc2ccc3c(c2)OCO3)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H20NO2/c1-20(2)15-6-4-5-7-16(15)21(3)19(20)11-9-14-8-10-17-18(12-14)23-13-22-17/h4-12H,13H2,1-3H3/q+1 |
| InChIKey | HUDKZKCSVCURRB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|