C22H21IN2 — CID 129314972
3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinoline iodide (PubChem CID 129314972) has the molecular formula C22H21IN2 and a molecular weight of 440.33 g/mol. Its IUPAC name is 3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinoline iodide.
| Compound Name | 3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinoline iodide |
|---|---|
| PubChem CID | 129314972 |
| Molecular Formula | C22H21IN2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 3-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinoline iodide |
| SMILES | C[N+]1=C(/C=C/c2cnc3ccccc3c2)C(C)(C)c2ccccc21.[I-] |
| InChI | InChI=1S/C22H21N2.HI/c1-22(2)18-9-5-7-11-20(18)24(3)21(22)13-12-16-14-17-8-4-6-10-19(17)23-15-16;/h4-15H,1-3H3;1H/q+1;/p-1 |
| InChIKey | STYGLMYPJZZSET-UHFFFAOYSA-M |
| XLogP | 1.96 |
| TPSA | 15.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|