About 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol
5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol (PubChem CID 137271278) has the molecular formula C22H20ClN2O+
and a molecular weight of 363.87 g/mol. Its IUPAC name is 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol.
Molecular Properties
| Compound Name | 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol |
| PubChem CID | 137271278 |
| Molecular Formula | C22H20ClN2O+ |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol |
| SMILES | C[N+]1=C(C=Cc2cc(Cl)c3cccnc3c2O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H19ClN2O/c1-22(2)16-8-4-5-9-18(16)25(3)19(22)11-10-14-13-17(23)15-7-6-12-24-20(15)21(14)26/h4-13H,1-3H3/p+1 |
| InChIKey | KRVBBBSQEXZGAV-UHFFFAOYSA-O |
| XLogP | 5.31 |
| TPSA | 36.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol?
The IUPAC name of 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol (CID 137271278) is 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol.
What is the SMILES notation for 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol?
The canonical SMILES for 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol is C[N+]1=C(C=Cc2cc(Cl)c3cccnc3c2O)C(C)(C)c2ccccc21.
What is the InChIKey of 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol?
The InChIKey is KRVBBBSQEXZGAV-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H19ClN2O/c1-22(2)16-8-4-5-9-18(16)25(3)19(22)11-10-14-13-17(23)15-7-6-12-24-20(15)21(14)26/h4-13H,1-3H3/p+1.
What are the key properties of 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol?
5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol has a molecular weight of 363.87 g/mol, XLogP of 5.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-7-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]quinolin-8-ol is sourced from PubChem (CID 137271278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).