C9H5Cl2NNiO — CID 175096460
5,7-dichloroquinolin-8-ol;nickel (PubChem CID 175096460) has the molecular formula C9H5Cl2NNiO and a molecular weight of 272.74 g/mol. Its IUPAC name is 5,7-dichloroquinolin-8-ol;nickel.
| Compound Name | 5,7-dichloroquinolin-8-ol;nickel |
|---|---|
| PubChem CID | 175096460 |
| Molecular Formula | C9H5Cl2NNiO |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 270.91 |
| IUPAC Name | 5,7-dichloroquinolin-8-ol;nickel |
| SMILES | Oc1c(Cl)cc(Cl)c2cccnc12.[Ni] |
| InChI | InChI=1S/C9H5Cl2NO.Ni/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;/h1-4,13H; |
| InChIKey | WUGMDCOUJDENDG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |