About bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium
bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium (PubChem CID 174375866) has the molecular formula C21H17Cl2I2N2O2Zr-
and a molecular weight of 745.32 g/mol. Its IUPAC name is bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium.
Molecular Properties
| Compound Name | bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium |
| PubChem CID | 174375866 |
| Molecular Formula | C21H17Cl2I2N2O2Zr- |
| Molecular Weight | 745.32 g/mol |
| Exact Mass | 742.78 |
| IUPAC Name | bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium |
| SMILES | C[CH-]C.Oc1c(I)cc(Cl)c2cccnc12.Oc1c(I)cc(Cl)c2cccnc12.[Zr] |
| InChI | InChI=1S/2C9H5ClINO.C3H7.Zr/c2*10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;1-3-2;/h2*1-4,13H;3H,1-2H3;/q;;-1; |
| InChIKey | UEQDQEDLWZSKHS-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 745.32 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium?
The IUPAC name of bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium (CID 174375866) is bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium.
What is the SMILES notation for bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium?
The canonical SMILES for bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium is C[CH-]C.Oc1c(I)cc(Cl)c2cccnc12.Oc1c(I)cc(Cl)c2cccnc12.[Zr].
What is the InChIKey of bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium?
The InChIKey is UEQDQEDLWZSKHS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H5ClINO.C3H7.Zr/c2*10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;1-3-2;/h2*1-4,13H;3H,1-2H3;/q;;-1;.
What are the key properties of bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium?
bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium has a molecular weight of 745.32 g/mol, XLogP of 7.62, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-chloro-7-iodoquinolin-8-ol);propane;zirconium is sourced from PubChem (CID 174375866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).