About bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+)
bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+) (PubChem CID 25009413) has the molecular formula C18H10Cl2GaI2N2O2+3
and a molecular weight of 677.93 g/mol. Its IUPAC name is bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+).
Molecular Properties
| Compound Name | bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+) |
| PubChem CID | 25009413 |
| Molecular Formula | C18H10Cl2GaI2N2O2+3 |
| Molecular Weight | 677.93 g/mol |
| Exact Mass | 676.75 |
| IUPAC Name | bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+) |
| SMILES | Oc1c(I)cc(Cl)c2cccnc12.Oc1c(I)cc(Cl)c2cccnc12.[67Ga+3] |
| InChI | InChI=1S/2C9H5ClINO.Ga/c2*10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;/h2*1-4,13H;/q;;+3/i;;1-3 |
| InChIKey | ZEJHAWXFIGGLJG-SIUYXFDKSA-N |
| XLogP | 6.02 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 677.93 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+)?
The IUPAC name of bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+) (CID 25009413) is bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+).
What is the SMILES notation for bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+)?
The canonical SMILES for bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+) is Oc1c(I)cc(Cl)c2cccnc12.Oc1c(I)cc(Cl)c2cccnc12.[67Ga+3].
What is the InChIKey of bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+)?
The InChIKey is ZEJHAWXFIGGLJG-SIUYXFDKSA-N. The full InChI is InChI=1S/2C9H5ClINO.Ga/c2*10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;/h2*1-4,13H;/q;;+3/i;;1-3.
What are the key properties of bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+)?
bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+) has a molecular weight of 677.93 g/mol, XLogP of 6.02, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-chloro-7-iodoquinolin-8-ol);gallium-67(3+) is sourced from PubChem (CID 25009413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).