C9H4Cl3NO — CID 10999408
4,5,7-trichloroquinolin-8-ol (PubChem CID 10999408) has the molecular formula C9H4Cl3NO and a molecular weight of 248.50 g/mol. Its IUPAC name is 4,5,7-trichloroquinolin-8-ol.
| Compound Name | 4,5,7-trichloroquinolin-8-ol |
|---|---|
| PubChem CID | 10999408 |
| Molecular Formula | C9H4Cl3NO |
| Molecular Weight | 248.50 g/mol |
| Exact Mass | 246.94 |
| IUPAC Name | 4,5,7-trichloroquinolin-8-ol |
| SMILES | Oc1c(Cl)cc(Cl)c2c(Cl)ccnc12 |
| InChI | InChI=1S/C9H4Cl3NO/c10-4-1-2-13-8-7(4)5(11)3-6(12)9(8)14/h1-3,14H |
| InChIKey | FQGGQGZSYUIWKW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |