About 4,5,7-trichloroquinolin-8-ol
4,5,7-trichloroquinolin-8-ol (PubChem CID 10999408) has the molecular formula C9H4Cl3NO
and a molecular weight of 248.50 g/mol. Its IUPAC name is 4,5,7-trichloroquinolin-8-ol.
Molecular Properties
| Compound Name | 4,5,7-trichloroquinolin-8-ol |
| PubChem CID | 10999408 |
| Molecular Formula | C9H4Cl3NO |
| Molecular Weight | 248.50 g/mol |
| Exact Mass | 246.94 |
| IUPAC Name | 4,5,7-trichloroquinolin-8-ol |
| SMILES | Oc1c(Cl)cc(Cl)c2c(Cl)ccnc12 |
| InChI | InChI=1S/C9H4Cl3NO/c10-4-1-2-13-8-7(4)5(11)3-6(12)9(8)14/h1-3,14H |
| InChIKey | FQGGQGZSYUIWKW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5,7-trichloroquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,7-trichloroquinolin-8-ol?
The IUPAC name of 4,5,7-trichloroquinolin-8-ol (CID 10999408) is 4,5,7-trichloroquinolin-8-ol.
What is the SMILES notation for 4,5,7-trichloroquinolin-8-ol?
The canonical SMILES for 4,5,7-trichloroquinolin-8-ol is Oc1c(Cl)cc(Cl)c2c(Cl)ccnc12.
What is the InChIKey of 4,5,7-trichloroquinolin-8-ol?
The InChIKey is FQGGQGZSYUIWKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4Cl3NO/c10-4-1-2-13-8-7(4)5(11)3-6(12)9(8)14/h1-3,14H.
What are the key properties of 4,5,7-trichloroquinolin-8-ol?
4,5,7-trichloroquinolin-8-ol has a molecular weight of 248.50 g/mol, XLogP of 3.90, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,7-trichloroquinolin-8-ol is sourced from PubChem (CID 10999408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).