C9H4Cl3N — CID 615835
4,5,7-trichloroquinoline (PubChem CID 615835) has the molecular formula C9H4Cl3N and a molecular weight of 232.50 g/mol. Its IUPAC name is 4,5,7-trichloroquinoline.
| Compound Name | 4,5,7-trichloroquinoline |
|---|---|
| PubChem CID | 615835 |
| Molecular Formula | C9H4Cl3N |
| Molecular Weight | 232.50 g/mol |
| Exact Mass | 230.94 |
| IUPAC Name | 4,5,7-trichloroquinoline |
| SMILES | Clc1cc(Cl)c2c(Cl)ccnc2c1 |
| InChI | InChI=1S/C9H4Cl3N/c10-5-3-7(12)9-6(11)1-2-13-8(9)4-5/h1-4H |
| InChIKey | WWFMSYKATMDLJP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |