C15H9Cl2N — CID 117062319
5,7-dichloro-4-phenylquinoline (PubChem CID 117062319) has the molecular formula C15H9Cl2N and a molecular weight of 274.15 g/mol. Its IUPAC name is 5,7-dichloro-4-phenylquinoline.
| Compound Name | 5,7-dichloro-4-phenylquinoline |
|---|---|
| PubChem CID | 117062319 |
| Molecular Formula | C15H9Cl2N |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 5,7-dichloro-4-phenylquinoline |
| SMILES | Clc1cc(Cl)c2c(-c3ccccc3)ccnc2c1 |
| InChI | InChI=1S/C15H9Cl2N/c16-11-8-13(17)15-12(6-7-18-14(15)9-11)10-4-2-1-3-5-10/h1-9H |
| InChIKey | WAKCTGVNVZJILP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |