C13H14Cl4 — CID 175257985
2,4-dichloro-1-phenylbenzene;methane;dihydrochloride (PubChem CID 175257985) has the molecular formula C13H14Cl4 and a molecular weight of 312.07 g/mol. Its IUPAC name is 2,4-dichloro-1-phenylbenzene;methane;dihydrochloride.
| Compound Name | 2,4-dichloro-1-phenylbenzene;methane;dihydrochloride |
|---|---|
| PubChem CID | 175257985 |
| Molecular Formula | C13H14Cl4 |
| Molecular Weight | 312.07 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 2,4-dichloro-1-phenylbenzene;methane;dihydrochloride |
| SMILES | C.Cl.Cl.Clc1ccc(-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C12H8Cl2.CH4.2ClH/c13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9;;;/h1-8H;1H4;2*1H |
| InChIKey | ODDZMRAASYKCMF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.07 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |