C13H7Cl2F3 — CID 54501466
2,4-dichloro-1-[4-(trifluoromethyl)phenyl]benzene (PubChem CID 54501466) has the molecular formula C13H7Cl2F3 and a molecular weight of 291.10 g/mol. Its IUPAC name is 2,4-dichloro-1-[4-(trifluoromethyl)phenyl]benzene.
| Compound Name | 2,4-dichloro-1-[4-(trifluoromethyl)phenyl]benzene |
|---|---|
| PubChem CID | 54501466 |
| Molecular Formula | C13H7Cl2F3 |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 2,4-dichloro-1-[4-(trifluoromethyl)phenyl]benzene |
| SMILES | FC(F)(F)c1ccc(-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H7Cl2F3/c14-10-5-6-11(12(15)7-10)8-1-3-9(4-2-8)13(16,17)18/h1-7H |
| InChIKey | GIJHCUFTGBIFIS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |