About chloromethane;1-chloro-4-(trifluoromethyl)benzene
chloromethane;1-chloro-4-(trifluoromethyl)benzene (PubChem CID 162019017) has the molecular formula C8H7Cl2F3
and a molecular weight of 231.04 g/mol. Its IUPAC name is chloromethane;1-chloro-4-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | chloromethane;1-chloro-4-(trifluoromethyl)benzene |
| PubChem CID | 162019017 |
| Molecular Formula | C8H7Cl2F3 |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | chloromethane;1-chloro-4-(trifluoromethyl)benzene |
| SMILES | CCl.FC(F)(F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H4ClF3.CH3Cl/c8-6-3-1-5(2-4-6)7(9,10)11;1-2/h1-4H;1H3 |
| InChIKey | YUMRYCRDELLRMH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;1-chloro-4-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;1-chloro-4-(trifluoromethyl)benzene?
The IUPAC name of chloromethane;1-chloro-4-(trifluoromethyl)benzene (CID 162019017) is chloromethane;1-chloro-4-(trifluoromethyl)benzene.
What is the SMILES notation for chloromethane;1-chloro-4-(trifluoromethyl)benzene?
The canonical SMILES for chloromethane;1-chloro-4-(trifluoromethyl)benzene is CCl.FC(F)(F)c1ccc(Cl)cc1.
What is the InChIKey of chloromethane;1-chloro-4-(trifluoromethyl)benzene?
The InChIKey is YUMRYCRDELLRMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClF3.CH3Cl/c8-6-3-1-5(2-4-6)7(9,10)11;1-2/h1-4H;1H3.
What are the key properties of chloromethane;1-chloro-4-(trifluoromethyl)benzene?
chloromethane;1-chloro-4-(trifluoromethyl)benzene has a molecular weight of 231.04 g/mol, XLogP of 4.21, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;1-chloro-4-(trifluoromethyl)benzene is sourced from PubChem (CID 162019017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).