C15H12ClF3N4 — CID 5360955
2-[(Z)-[(4-chlorophenyl)-[4-(trifluoromethyl)phenyl]methylidene]amino]guanidine (PubChem CID 5360955) has the molecular formula C15H12ClF3N4 and a molecular weight of 340.74 g/mol. Its IUPAC name is 2-[(Z)-[(4-chlorophenyl)-[4-(trifluoromethyl)phenyl]methylidene]amino]guanidine.
| Compound Name | 2-[(Z)-[(4-chlorophenyl)-[4-(trifluoromethyl)phenyl]methylidene]amino]guanidine |
|---|---|
| PubChem CID | 5360955 |
| Molecular Formula | C15H12ClF3N4 |
| Molecular Weight | 340.74 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-[(Z)-[(4-chlorophenyl)-[4-(trifluoromethyl)phenyl]methylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C(\c1ccc(Cl)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12ClF3N4/c16-12-7-3-10(4-8-12)13(22-23-14(20)21)9-1-5-11(6-2-9)15(17,18)19/h1-8H,(H4,20,21,23)/b22-13- |
| InChIKey | AJJOTBLQSCCRON-XKZIYDEJSA-N |
| XLogP | 3.38 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|