C14H13FN4 — CID 5474390
2-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]guanidine (PubChem CID 5474390) has the molecular formula C14H13FN4 and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]guanidine.
| Compound Name | 2-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]guanidine |
|---|---|
| PubChem CID | 5474390 |
| Molecular Formula | C14H13FN4 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-[(Z)-[(4-fluorophenyl)-phenylmethylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C(/c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H13FN4/c15-12-8-6-11(7-9-12)13(18-19-14(16)17)10-4-2-1-3-5-10/h1-9H,(H4,16,17,19)/b18-13- |
| InChIKey | JUWZFJBPSYJZPX-AQTBWJFISA-N |
| XLogP | 1.85 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|