C14H14N4O2 — CID 135460269
2-[(Z)-[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]guanidine (PubChem CID 135460269) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[(Z)-[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]guanidine.
| Compound Name | 2-[(Z)-[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]guanidine |
|---|---|
| PubChem CID | 135460269 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[(Z)-[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]guanidine |
| SMILES | NC(N)=N/N=C(/c1ccccc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H14N4O2/c15-14(16)18-17-13(9-4-2-1-3-5-9)11-7-6-10(19)8-12(11)20/h1-8,19-20H,(H4,15,16,18)/b17-13- |
| InChIKey | RUPHXHIMLGNAQP-LGMDPLHJSA-N |
| XLogP | 1.12 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|