C13H11NO3 — CID 136722434
2-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]benzene-1,4-diol (PubChem CID 136722434) has the molecular formula C13H11NO3 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]benzene-1,4-diol.
| Compound Name | 2-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 136722434 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-[(Z)-N-hydroxy-C-phenylcarbonimidoyl]benzene-1,4-diol |
| SMILES | O/N=C(/c1ccccc1)c1cc(O)ccc1O |
| InChI | InChI=1S/C13H11NO3/c15-10-6-7-12(16)11(8-10)13(14-17)9-4-2-1-3-5-9/h1-8,15-17H/b14-13- |
| InChIKey | JWGKUAYCNSMLSH-YPKPFQOOSA-N |
| XLogP | 2.32 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|