C8H9NO3 — CID 135589061
2-[(E)-N-hydroxy-C-methylcarbonimidoyl]benzene-1,4-diol (PubChem CID 135589061) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]benzene-1,4-diol.
| Compound Name | 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 135589061 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-[(E)-N-hydroxy-C-methylcarbonimidoyl]benzene-1,4-diol |
| SMILES | C/C(=N\O)c1cc(O)ccc1O |
| InChI | InChI=1S/C8H9NO3/c1-5(9-12)7-4-6(10)2-3-8(7)11/h2-4,10-12H,1H3/b9-5+ |
| InChIKey | QIXQBIKGARTNDN-WEVVVXLNSA-N |
| XLogP | 1.30 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|