C11H12O3 — CID 86168329
1-(2,5-dihydroxyphenyl)-3-methylbut-2-en-1-one (PubChem CID 86168329) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 1-(2,5-dihydroxyphenyl)-3-methylbut-2-en-1-one.
| Compound Name | 1-(2,5-dihydroxyphenyl)-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 86168329 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 1-(2,5-dihydroxyphenyl)-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C11H12O3/c1-7(2)5-11(14)9-6-8(12)3-4-10(9)13/h3-6,12-13H,1-2H3 |
| InChIKey | NGGQWOLOGKVNIW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|