C7H5LiO4 — CID 55251260
lithium 2,5-dihydroxybenzoate (PubChem CID 55251260) has the molecular formula C7H5LiO4 and a molecular weight of 160.05 g/mol. Its IUPAC name is lithium 2,5-dihydroxybenzoate.
| Compound Name | lithium 2,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 55251260 |
| Molecular Formula | C7H5LiO4 |
| Molecular Weight | 160.05 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | lithium 2,5-dihydroxybenzoate |
| SMILES | O=C([O-])c1cc(O)ccc1O.[Li+] |
| InChI | InChI=1S/C7H6O4.Li/c8-4-1-2-6(9)5(3-4)7(10)11;/h1-3,8-9H,(H,10,11);/q;+1/p-1 |
| InChIKey | JWJQXDRUZXWVQB-UHFFFAOYSA-M |
| XLogP | -3.53 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.05 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|