C10H22N4O10 — CID 139073121
tetraazanium;benzene-1,2,4,5-tetracarboxylate;dihydrate (PubChem CID 139073121) has the molecular formula C10H22N4O10 and a molecular weight of 358.30 g/mol. Its IUPAC name is tetraazanium;benzene-1,2,4,5-tetracarboxylate;dihydrate.
| Compound Name | tetraazanium;benzene-1,2,4,5-tetracarboxylate;dihydrate |
|---|---|
| PubChem CID | 139073121 |
| Molecular Formula | C10H22N4O10 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | tetraazanium;benzene-1,2,4,5-tetracarboxylate;dihydrate |
| SMILES | O.O.O=C([O-])c1cc(C(=O)[O-])c(C(=O)[O-])cc1C(=O)[O-].[NH4+].[NH4+].[NH4+].[NH4+] |
| InChI | InChI=1S/C10H6O8.4H3N.2H2O/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16;;;;;;/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18);4*1H3;2*1H2 |
| InChIKey | HIKJRMFZCVERFC-UHFFFAOYSA-N |
| XLogP | -5.00 |
| TPSA | 369.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | -5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |