C13H11K3O7 — CID 176556714
tripotassium;5-acetylbenzene-1,2,4-tricarboxylate;ethane (PubChem CID 176556714) has the molecular formula C13H11K3O7 and a molecular weight of 396.52 g/mol. Its IUPAC name is tripotassium;5-acetylbenzene-1,2,4-tricarboxylate;ethane.
| Compound Name | tripotassium;5-acetylbenzene-1,2,4-tricarboxylate;ethane |
|---|---|
| PubChem CID | 176556714 |
| Molecular Formula | C13H11K3O7 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 395.94 |
| IUPAC Name | tripotassium;5-acetylbenzene-1,2,4-tricarboxylate;ethane |
| SMILES | CC.CC(=O)c1cc(C(=O)[O-])c(C(=O)[O-])cc1C(=O)[O-].[K+].[K+].[K+] |
| InChI | InChI=1S/C11H8O7.C2H6.3K/c1-4(12)5-2-7(10(15)16)8(11(17)18)3-6(5)9(13)14;1-2;;;/h2-3H,1H3,(H,13,14)(H,15,16)(H,17,18);1-2H3;;;/q;;3*+1/p-3 |
| InChIKey | XMIQEDFBOJPXNC-UHFFFAOYSA-K |
| XLogP | -10.98 |
| TPSA | 137.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | -10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |