About potassium;3-acetyl-2-hydroxybenzoate;dihydrate
potassium;3-acetyl-2-hydroxybenzoate;dihydrate (PubChem CID 67923270) has the molecular formula C9H11KO6
and a molecular weight of 254.28 g/mol. Its IUPAC name is potassium;3-acetyl-2-hydroxybenzoate;dihydrate.
Molecular Properties
| Compound Name | potassium;3-acetyl-2-hydroxybenzoate;dihydrate |
| PubChem CID | 67923270 |
| Molecular Formula | C9H11KO6 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | potassium;3-acetyl-2-hydroxybenzoate;dihydrate |
| SMILES | CC(=O)c1cccc(C(=O)[O-])c1O.O.O.[K+] |
| InChI | InChI=1S/C9H8O4.K.2H2O/c1-5(10)6-3-2-4-7(8(6)11)9(12)13;;;/h2-4,11H,1H3,(H,12,13);;2*1H2/q;+1;;/p-1 |
| InChIKey | WDVTXQFHJDRDPX-UHFFFAOYSA-M |
| XLogP | -4.69 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | -4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze potassium;3-acetyl-2-hydroxybenzoate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;3-acetyl-2-hydroxybenzoate;dihydrate?
The IUPAC name of potassium;3-acetyl-2-hydroxybenzoate;dihydrate (CID 67923270) is potassium;3-acetyl-2-hydroxybenzoate;dihydrate.
What is the SMILES notation for potassium;3-acetyl-2-hydroxybenzoate;dihydrate?
The canonical SMILES for potassium;3-acetyl-2-hydroxybenzoate;dihydrate is CC(=O)c1cccc(C(=O)[O-])c1O.O.O.[K+].
What is the InChIKey of potassium;3-acetyl-2-hydroxybenzoate;dihydrate?
The InChIKey is WDVTXQFHJDRDPX-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8O4.K.2H2O/c1-5(10)6-3-2-4-7(8(6)11)9(12)13;;;/h2-4,11H,1H3,(H,12,13);;2*1H2/q;+1;;/p-1.
What are the key properties of potassium;3-acetyl-2-hydroxybenzoate;dihydrate?
potassium;3-acetyl-2-hydroxybenzoate;dihydrate has a molecular weight of 254.28 g/mol, XLogP of -4.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;3-acetyl-2-hydroxybenzoate;dihydrate is sourced from PubChem (CID 67923270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).