About nickel(2+);phthalate
nickel(2+);phthalate (PubChem CID 15798393) has the molecular formula C8H4NiO4
and a molecular weight of 222.81 g/mol. Its IUPAC name is nickel(2+);phthalate.
Molecular Properties
| Compound Name | nickel(2+);phthalate |
| PubChem CID | 15798393 |
| Molecular Formula | C8H4NiO4 |
| Molecular Weight | 222.81 g/mol |
| Exact Mass | 221.95 |
| IUPAC Name | nickel(2+);phthalate |
| SMILES | O=C([O-])c1ccccc1C(=O)[O-].[Ni+2] |
| InChI | InChI=1S/C8H6O4.Ni/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+2/p-2 |
| InChIKey | YHSKWXTXQWGSIG-UHFFFAOYSA-L |
| XLogP | -1.59 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.81 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze nickel(2+);phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);phthalate?
The IUPAC name of nickel(2+);phthalate (CID 15798393) is nickel(2+);phthalate.
What is the SMILES notation for nickel(2+);phthalate?
The canonical SMILES for nickel(2+);phthalate is O=C([O-])c1ccccc1C(=O)[O-].[Ni+2].
What is the InChIKey of nickel(2+);phthalate?
The InChIKey is YHSKWXTXQWGSIG-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H6O4.Ni/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+2/p-2.
What are the key properties of nickel(2+);phthalate?
nickel(2+);phthalate has a molecular weight of 222.81 g/mol, XLogP of -1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);phthalate is sourced from PubChem (CID 15798393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).