About lithium 2-carboxybenzoate
lithium 2-carboxybenzoate (PubChem CID 67386197) has the molecular formula C8H5LiO4
and a molecular weight of 172.06 g/mol. Its IUPAC name is lithium 2-carboxybenzoate.
Molecular Properties
| Compound Name | lithium 2-carboxybenzoate |
| PubChem CID | 67386197 |
| Molecular Formula | C8H5LiO4 |
| Molecular Weight | 172.06 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | lithium 2-carboxybenzoate |
| SMILES | O=C([O-])c1ccccc1C(=O)O.[Li+] |
| InChI | InChI=1S/C8H6O4.Li/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+1/p-1 |
| InChIKey | LJURPJZOPVZKTQ-UHFFFAOYSA-M |
| XLogP | -3.25 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.06 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze lithium 2-carboxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-carboxybenzoate?
The IUPAC name of lithium 2-carboxybenzoate (CID 67386197) is lithium 2-carboxybenzoate.
What is the SMILES notation for lithium 2-carboxybenzoate?
The canonical SMILES for lithium 2-carboxybenzoate is O=C([O-])c1ccccc1C(=O)O.[Li+].
What is the InChIKey of lithium 2-carboxybenzoate?
The InChIKey is LJURPJZOPVZKTQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6O4.Li/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+1/p-1.
What are the key properties of lithium 2-carboxybenzoate?
lithium 2-carboxybenzoate has a molecular weight of 172.06 g/mol, XLogP of -3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-carboxybenzoate is sourced from PubChem (CID 67386197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).