About potassium;2-carboxybenzoate;hydrofluoride
potassium;2-carboxybenzoate;hydrofluoride (PubChem CID 174556372) has the molecular formula C8H6FKO4
and a molecular weight of 224.23 g/mol. Its IUPAC name is potassium;2-carboxybenzoate;hydrofluoride.
Molecular Properties
| Compound Name | potassium;2-carboxybenzoate;hydrofluoride |
| PubChem CID | 174556372 |
| Molecular Formula | C8H6FKO4 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | potassium;2-carboxybenzoate;hydrofluoride |
| SMILES | F.O=C([O-])c1ccccc1C(=O)O.[K+] |
| InChI | InChI=1S/C8H6O4.FH.K/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);1H;/q;;+1/p-1 |
| InChIKey | QNOMTHLBOBXPPZ-UHFFFAOYSA-M |
| XLogP | -3.10 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | -3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;2-carboxybenzoate;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-carboxybenzoate;hydrofluoride?
The IUPAC name of potassium;2-carboxybenzoate;hydrofluoride (CID 174556372) is potassium;2-carboxybenzoate;hydrofluoride.
What is the SMILES notation for potassium;2-carboxybenzoate;hydrofluoride?
The canonical SMILES for potassium;2-carboxybenzoate;hydrofluoride is F.O=C([O-])c1ccccc1C(=O)O.[K+].
What is the InChIKey of potassium;2-carboxybenzoate;hydrofluoride?
The InChIKey is QNOMTHLBOBXPPZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6O4.FH.K/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);1H;/q;;+1/p-1.
What are the key properties of potassium;2-carboxybenzoate;hydrofluoride?
potassium;2-carboxybenzoate;hydrofluoride has a molecular weight of 224.23 g/mol, XLogP of -3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-carboxybenzoate;hydrofluoride is sourced from PubChem (CID 174556372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).