About 2-carboxybenzoate;thallium(1+)
2-carboxybenzoate;thallium(1+) (PubChem CID 101403196) has the molecular formula C8H5O4Tl
and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-carboxybenzoate;thallium(1+).
Molecular Properties
| Compound Name | 2-carboxybenzoate;thallium(1+) |
| PubChem CID | 101403196 |
| Molecular Formula | C8H5O4Tl |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 2-carboxybenzoate;thallium(1+) |
| SMILES | O=C([O-])c1ccccc1C(=O)O.[Tl+] |
| InChI | InChI=1S/C8H6O4.Tl/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+1/p-1 |
| InChIKey | DYFSNVWVAGIZTO-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-carboxybenzoate;thallium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxybenzoate;thallium(1+)?
The IUPAC name of 2-carboxybenzoate;thallium(1+) (CID 101403196) is 2-carboxybenzoate;thallium(1+).
What is the SMILES notation for 2-carboxybenzoate;thallium(1+)?
The canonical SMILES for 2-carboxybenzoate;thallium(1+) is O=C([O-])c1ccccc1C(=O)O.[Tl+].
What is the InChIKey of 2-carboxybenzoate;thallium(1+)?
The InChIKey is DYFSNVWVAGIZTO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6O4.Tl/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+1/p-1.
What are the key properties of 2-carboxybenzoate;thallium(1+)?
2-carboxybenzoate;thallium(1+) has a molecular weight of 369.51 g/mol, XLogP of -0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxybenzoate;thallium(1+) is sourced from PubChem (CID 101403196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).