About 2-carboxybenzoate;rubidium(1+)
2-carboxybenzoate;rubidium(1+) (PubChem CID 23665340) has the molecular formula C8H5O4Rb
and a molecular weight of 250.59 g/mol. Its IUPAC name is 2-carboxybenzoate;rubidium(1+).
Molecular Properties
| Compound Name | 2-carboxybenzoate;rubidium(1+) |
| PubChem CID | 23665340 |
| Molecular Formula | C8H5O4Rb |
| Molecular Weight | 250.59 g/mol |
| Exact Mass | 249.93 |
| IUPAC Name | 2-carboxybenzoate;rubidium(1+) |
| SMILES | O=C([O-])c1ccccc1C(=O)O.[Rb+] |
| InChI | InChI=1S/C8H6O4.Rb/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+1/p-1 |
| InChIKey | XESNEJYDNWIZHN-UHFFFAOYSA-M |
| XLogP | -3.25 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.59 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-carboxybenzoate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxybenzoate;rubidium(1+)?
The IUPAC name of 2-carboxybenzoate;rubidium(1+) (CID 23665340) is 2-carboxybenzoate;rubidium(1+).
What is the SMILES notation for 2-carboxybenzoate;rubidium(1+)?
The canonical SMILES for 2-carboxybenzoate;rubidium(1+) is O=C([O-])c1ccccc1C(=O)O.[Rb+].
What is the InChIKey of 2-carboxybenzoate;rubidium(1+)?
The InChIKey is XESNEJYDNWIZHN-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6O4.Rb/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+1/p-1.
What are the key properties of 2-carboxybenzoate;rubidium(1+)?
2-carboxybenzoate;rubidium(1+) has a molecular weight of 250.59 g/mol, XLogP of -3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxybenzoate;rubidium(1+) is sourced from PubChem (CID 23665340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).