About potassium;azane;2-carboxybenzoate
potassium;azane;2-carboxybenzoate (PubChem CID 174947787) has the molecular formula C8H8KNO4
and a molecular weight of 221.25 g/mol. Its IUPAC name is potassium;azane;2-carboxybenzoate.
Molecular Properties
| Compound Name | potassium;azane;2-carboxybenzoate |
| PubChem CID | 174947787 |
| Molecular Formula | C8H8KNO4 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | potassium;azane;2-carboxybenzoate |
| SMILES | N.O=C([O-])c1ccccc1C(=O)O.[K+] |
| InChI | InChI=1S/C8H6O4.K.H3N/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;1H3/q;+1;/p-1 |
| InChIKey | PEJLMKPJJQPRMK-UHFFFAOYSA-M |
| XLogP | -3.09 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze potassium;azane;2-carboxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;azane;2-carboxybenzoate?
The IUPAC name of potassium;azane;2-carboxybenzoate (CID 174947787) is potassium;azane;2-carboxybenzoate.
What is the SMILES notation for potassium;azane;2-carboxybenzoate?
The canonical SMILES for potassium;azane;2-carboxybenzoate is N.O=C([O-])c1ccccc1C(=O)O.[K+].
What is the InChIKey of potassium;azane;2-carboxybenzoate?
The InChIKey is PEJLMKPJJQPRMK-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6O4.K.H3N/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;1H3/q;+1;/p-1.
What are the key properties of potassium;azane;2-carboxybenzoate?
potassium;azane;2-carboxybenzoate has a molecular weight of 221.25 g/mol, XLogP of -3.09, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;azane;2-carboxybenzoate is sourced from PubChem (CID 174947787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).