About disodium;hydron;phthalate
disodium;hydron;phthalate (PubChem CID 23089010) has the molecular formula C8H5Na2O4+
and a molecular weight of 211.10 g/mol. Its IUPAC name is disodium;hydron;phthalate.
Molecular Properties
| Compound Name | disodium;hydron;phthalate |
| PubChem CID | 23089010 |
| Molecular Formula | C8H5Na2O4+ |
| Molecular Weight | 211.10 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | disodium;hydron;phthalate |
| SMILES | O=C([O-])c1ccccc1C(=O)[O-].[H+].[Na+].[Na+] |
| InChI | InChI=1S/C8H6O4.2Na/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;/q;2*+1/p-1 |
| InChIKey | HQWKKEIVHQXCPI-UHFFFAOYSA-M |
| XLogP | -7.47 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.10 |
| LogP ≤ 5 | -7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze disodium;hydron;phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;hydron;phthalate?
The IUPAC name of disodium;hydron;phthalate (CID 23089010) is disodium;hydron;phthalate.
What is the SMILES notation for disodium;hydron;phthalate?
The canonical SMILES for disodium;hydron;phthalate is O=C([O-])c1ccccc1C(=O)[O-].[H+].[Na+].[Na+].
What is the InChIKey of disodium;hydron;phthalate?
The InChIKey is HQWKKEIVHQXCPI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H6O4.2Na/c9-7(10)5-3-1-2-4-6(5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;/q;2*+1/p-1.
What are the key properties of disodium;hydron;phthalate?
disodium;hydron;phthalate has a molecular weight of 211.10 g/mol, XLogP of -7.47, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;hydron;phthalate is sourced from PubChem (CID 23089010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).