About 2-carbamoylbenzoate
2-carbamoylbenzoate (PubChem CID 3373391) has the molecular formula C8H6NO3-
and a molecular weight of 164.14 g/mol. Its IUPAC name is 2-carbamoylbenzoate.
Molecular Properties
| Compound Name | 2-carbamoylbenzoate |
| PubChem CID | 3373391 |
| Molecular Formula | C8H6NO3- |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 2-carbamoylbenzoate |
| SMILES | NC(=O)c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12)/p-1 |
| InChIKey | CYMRPDYINXWJFU-UHFFFAOYSA-M |
| XLogP | -0.85 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-carbamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamoylbenzoate?
The IUPAC name of 2-carbamoylbenzoate (CID 3373391) is 2-carbamoylbenzoate.
What is the SMILES notation for 2-carbamoylbenzoate?
The canonical SMILES for 2-carbamoylbenzoate is NC(=O)c1ccccc1C(=O)[O-].
What is the InChIKey of 2-carbamoylbenzoate?
The InChIKey is CYMRPDYINXWJFU-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7NO3/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H2,9,10)(H,11,12)/p-1.
What are the key properties of 2-carbamoylbenzoate?
2-carbamoylbenzoate has a molecular weight of 164.14 g/mol, XLogP of -0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamoylbenzoate is sourced from PubChem (CID 3373391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).