C8H12N4O2 — CID 158131121
benzene-1,2-dicarboxamide;hydrazine (PubChem CID 158131121) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is benzene-1,2-dicarboxamide;hydrazine.
| Compound Name | benzene-1,2-dicarboxamide;hydrazine |
|---|---|
| PubChem CID | 158131121 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | benzene-1,2-dicarboxamide;hydrazine |
| SMILES | NC(=O)c1ccccc1C(N)=O.NN |
| InChI | InChI=1S/C8H8N2O2.H4N2/c9-7(11)5-3-1-2-4-6(5)8(10)12;1-2/h1-4H,(H2,9,11)(H2,10,12);1-2H2 |
| InChIKey | FSUBNZVERUHRDV-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|