About 2-iodobenzamide
2-iodobenzamide (PubChem CID 160670857) has the molecular formula C14H12I2N2O2
and a molecular weight of 494.07 g/mol. Its IUPAC name is 2-iodobenzamide.
Molecular Properties
| Compound Name | 2-iodobenzamide |
| PubChem CID | 160670857 |
| Molecular Formula | C14H12I2N2O2 |
| Molecular Weight | 494.07 g/mol |
| Exact Mass | 493.90 |
| IUPAC Name | 2-iodobenzamide |
| SMILES | NC(=O)c1ccccc1I.NC(=O)c1ccccc1I |
| InChI | InChI=1S/2C7H6INO/c2*8-6-4-2-1-3-5(6)7(9)10/h2*1-4H,(H2,9,10) |
| InChIKey | RMXJDFKTDDBSKD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.07 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodobenzamide?
The IUPAC name of 2-iodobenzamide (CID 160670857) is 2-iodobenzamide.
What is the SMILES notation for 2-iodobenzamide?
The canonical SMILES for 2-iodobenzamide is NC(=O)c1ccccc1I.NC(=O)c1ccccc1I.
What is the InChIKey of 2-iodobenzamide?
The InChIKey is RMXJDFKTDDBSKD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6INO/c2*8-6-4-2-1-3-5(6)7(9)10/h2*1-4H,(H2,9,10).
What are the key properties of 2-iodobenzamide?
2-iodobenzamide has a molecular weight of 494.07 g/mol, XLogP of 2.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodobenzamide is sourced from PubChem (CID 160670857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).