About 2-amino-3-iodobenzamide
2-amino-3-iodobenzamide (PubChem CID 67497450) has the molecular formula C7H7IN2O
and a molecular weight of 262.05 g/mol. Its IUPAC name is 2-amino-3-iodobenzamide.
Molecular Properties
| Compound Name | 2-amino-3-iodobenzamide |
| PubChem CID | 67497450 |
| Molecular Formula | C7H7IN2O |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 261.96 |
| IUPAC Name | 2-amino-3-iodobenzamide |
| SMILES | NC(=O)c1cccc(I)c1N |
| InChI | InChI=1S/C7H7IN2O/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,9H2,(H2,10,11) |
| InChIKey | MXXBQBUOMDYGJP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-iodobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-iodobenzamide?
The IUPAC name of 2-amino-3-iodobenzamide (CID 67497450) is 2-amino-3-iodobenzamide.
What is the SMILES notation for 2-amino-3-iodobenzamide?
The canonical SMILES for 2-amino-3-iodobenzamide is NC(=O)c1cccc(I)c1N.
What is the InChIKey of 2-amino-3-iodobenzamide?
The InChIKey is MXXBQBUOMDYGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7IN2O/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,9H2,(H2,10,11).
What are the key properties of 2-amino-3-iodobenzamide?
2-amino-3-iodobenzamide has a molecular weight of 262.05 g/mol, XLogP of 0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-iodobenzamide is sourced from PubChem (CID 67497450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).