C7H10ClN3O — CID 118989521
2,3-diaminobenzamide;hydrochloride (PubChem CID 118989521) has the molecular formula C7H10ClN3O and a molecular weight of 187.63 g/mol. Its IUPAC name is 2,3-diaminobenzamide;hydrochloride.
| Compound Name | 2,3-diaminobenzamide;hydrochloride |
|---|---|
| PubChem CID | 118989521 |
| Molecular Formula | C7H10ClN3O |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2,3-diaminobenzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cccc(N)c1N |
| InChI | InChI=1S/C7H9N3O.ClH/c8-5-3-1-2-4(6(5)9)7(10)11;/h1-3H,8-9H2,(H2,10,11);1H |
| InChIKey | KATIDBRDNZJLHY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|