About 2-aminobenzamide;piperazine
2-aminobenzamide;piperazine (PubChem CID 174878244) has the molecular formula C11H18N4O
and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-aminobenzamide;piperazine.
Molecular Properties
| Compound Name | 2-aminobenzamide;piperazine |
| PubChem CID | 174878244 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 2-aminobenzamide;piperazine |
| SMILES | C1CNCCN1.NC(=O)c1ccccc1N |
| InChI | InChI=1S/C7H8N2O.C4H10N2/c8-6-4-2-1-3-5(6)7(9)10;1-2-6-4-3-5-1/h1-4H,8H2,(H2,9,10);5-6H,1-4H2 |
| InChIKey | ZGOSIPKQKLCRPZ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzamide;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzamide;piperazine?
The IUPAC name of 2-aminobenzamide;piperazine (CID 174878244) is 2-aminobenzamide;piperazine.
What is the SMILES notation for 2-aminobenzamide;piperazine?
The canonical SMILES for 2-aminobenzamide;piperazine is C1CNCCN1.NC(=O)c1ccccc1N.
What is the InChIKey of 2-aminobenzamide;piperazine?
The InChIKey is ZGOSIPKQKLCRPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C4H10N2/c8-6-4-2-1-3-5(6)7(9)10;1-2-6-4-3-5-1/h1-4H,8H2,(H2,9,10);5-6H,1-4H2.
What are the key properties of 2-aminobenzamide;piperazine?
2-aminobenzamide;piperazine has a molecular weight of 222.29 g/mol, XLogP of -0.45, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzamide;piperazine is sourced from PubChem (CID 174878244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).