About 2-aminobenzamide;1H-pyridin-2-one
2-aminobenzamide;1H-pyridin-2-one (PubChem CID 68828870) has the molecular formula C12H13N3O2
and a molecular weight of 231.26 g/mol. Its IUPAC name is 2-aminobenzamide;1H-pyridin-2-one.
Molecular Properties
| Compound Name | 2-aminobenzamide;1H-pyridin-2-one |
| PubChem CID | 68828870 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-aminobenzamide;1H-pyridin-2-one |
| SMILES | NC(=O)c1ccccc1N.O=c1cccc[nH]1 |
| InChI | InChI=1S/C7H8N2O.C5H5NO/c8-6-4-2-1-3-5(6)7(9)10;7-5-3-1-2-4-6-5/h1-4H,8H2,(H2,9,10);1-4H,(H,6,7) |
| InChIKey | NXMIGTZIQNBDKA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 101.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzamide;1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzamide;1H-pyridin-2-one?
The IUPAC name of 2-aminobenzamide;1H-pyridin-2-one (CID 68828870) is 2-aminobenzamide;1H-pyridin-2-one.
What is the SMILES notation for 2-aminobenzamide;1H-pyridin-2-one?
The canonical SMILES for 2-aminobenzamide;1H-pyridin-2-one is NC(=O)c1ccccc1N.O=c1cccc[nH]1.
What is the InChIKey of 2-aminobenzamide;1H-pyridin-2-one?
The InChIKey is NXMIGTZIQNBDKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C5H5NO/c8-6-4-2-1-3-5(6)7(9)10;7-5-3-1-2-4-6-5/h1-4H,8H2,(H2,9,10);1-4H,(H,6,7).
What are the key properties of 2-aminobenzamide;1H-pyridin-2-one?
2-aminobenzamide;1H-pyridin-2-one has a molecular weight of 231.26 g/mol, XLogP of 0.74, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzamide;1H-pyridin-2-one is sourced from PubChem (CID 68828870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).