About CID 67588186
CID 67588186 (PubChem CID 67588186) has the molecular formula C8H8N2NaO2
and a molecular weight of 187.15 g/mol.
Molecular Properties
| Compound Name | CID 67588186 |
| PubChem CID | 67588186 |
| Molecular Formula | C8H8N2NaO2 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | — |
| SMILES | NC(=O)c1ccccc1C(N)=O.[Na] |
| InChI | InChI=1S/C8H8N2O2.Na/c9-7(11)5-3-1-2-4-6(5)8(10)12;/h1-4H,(H2,9,11)(H2,10,12); |
| InChIKey | ULGKXYNXXWDVON-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 67588186 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67588186?
The IUPAC name of CID 67588186 (CID 67588186) is not available.
What is the SMILES notation for CID 67588186?
The canonical SMILES for CID 67588186 is NC(=O)c1ccccc1C(N)=O.[Na].
What is the InChIKey of CID 67588186?
The InChIKey is ULGKXYNXXWDVON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2.Na/c9-7(11)5-3-1-2-4-6(5)8(10)12;/h1-4H,(H2,9,11)(H2,10,12);.
What are the key properties of CID 67588186?
CID 67588186 has a molecular weight of 187.15 g/mol, XLogP of -0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67588186 is sourced from PubChem (CID 67588186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).