About 2-oxaldehydoylbenzamide
2-oxaldehydoylbenzamide (PubChem CID 146295366) has the molecular formula C9H7NO3
and a molecular weight of 177.16 g/mol. Its IUPAC name is 2-oxaldehydoylbenzamide.
Molecular Properties
| Compound Name | 2-oxaldehydoylbenzamide |
| PubChem CID | 146295366 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 2-oxaldehydoylbenzamide |
| SMILES | NC(=O)c1ccccc1C(=O)C=O |
| InChI | InChI=1S/C9H7NO3/c10-9(13)7-4-2-1-3-6(7)8(12)5-11/h1-5H,(H2,10,13) |
| InChIKey | OAANRSHMIYQWFT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxaldehydoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxaldehydoylbenzamide?
The IUPAC name of 2-oxaldehydoylbenzamide (CID 146295366) is 2-oxaldehydoylbenzamide.
What is the SMILES notation for 2-oxaldehydoylbenzamide?
The canonical SMILES for 2-oxaldehydoylbenzamide is NC(=O)c1ccccc1C(=O)C=O.
What is the InChIKey of 2-oxaldehydoylbenzamide?
The InChIKey is OAANRSHMIYQWFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3/c10-9(13)7-4-2-1-3-6(7)8(12)5-11/h1-5H,(H2,10,13).
What are the key properties of 2-oxaldehydoylbenzamide?
2-oxaldehydoylbenzamide has a molecular weight of 177.16 g/mol, XLogP of 0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxaldehydoylbenzamide is sourced from PubChem (CID 146295366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).