About 2-fluorobenzamide;dihydrochloride
2-fluorobenzamide;dihydrochloride (PubChem CID 22563899) has the molecular formula C7H8Cl2FNO
and a molecular weight of 212.05 g/mol. Its IUPAC name is 2-fluorobenzamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-fluorobenzamide;dihydrochloride |
| PubChem CID | 22563899 |
| Molecular Formula | C7H8Cl2FNO |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 2-fluorobenzamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)c1ccccc1F |
| InChI | InChI=1S/C7H6FNO.2ClH/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4H,(H2,9,10);2*1H |
| InChIKey | YXGDNJQBYJVUOD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluorobenzamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobenzamide;dihydrochloride?
The IUPAC name of 2-fluorobenzamide;dihydrochloride (CID 22563899) is 2-fluorobenzamide;dihydrochloride.
What is the SMILES notation for 2-fluorobenzamide;dihydrochloride?
The canonical SMILES for 2-fluorobenzamide;dihydrochloride is Cl.Cl.NC(=O)c1ccccc1F.
What is the InChIKey of 2-fluorobenzamide;dihydrochloride?
The InChIKey is YXGDNJQBYJVUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FNO.2ClH/c8-6-4-2-1-3-5(6)7(9)10;;/h1-4H,(H2,9,10);2*1H.
What are the key properties of 2-fluorobenzamide;dihydrochloride?
2-fluorobenzamide;dihydrochloride has a molecular weight of 212.05 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobenzamide;dihydrochloride is sourced from PubChem (CID 22563899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).